![[ICO]](/icons/blank.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1-01 Shanehayat.mp3 | 2023-11-08 16:43 | 20M | |
| 1-02 Asheghtarin.mp3 | 2023-11-08 16:42 | 15M | |
| 1-03 Ey Zendegi Sala..> | 2023-11-08 16:42 | 16M | |
| 1-04 Sayeh Eshgh.mp3 | 2023-11-08 16:43 | 17M | |
| 1-05 Ki Midooneh.mp3 | 2023-11-08 16:42 | 13M | |
| 1-06 Afsaneh Hasty.mp3 | 2023-11-08 16:42 | 14M | |
| 1-07 Parishoon.mp3 | 2023-11-08 16:43 | 17M | |
| 1-08 Arosak.mp3 | 2023-11-08 16:43 | 14M | |
| 1-09 Ye Rooz.mp3 | 2023-11-08 16:43 | 15M | |
| 2-01 Nagoo Nemiyam.mp3 | 2023-11-08 16:43 | 15M | |
| 2-02 Siyah Cheshmoon..> | 2023-11-08 16:43 | 14M | |
| 2-03 Ashiyooneh.mp3 | 2023-11-08 16:43 | 15M | |
| 2-04 Asal Cheshm.mp3 | 2023-11-08 16:43 | 10M | |
| 2-05 Bahar Bahar.mp3 | 2023-11-08 16:43 | 13M | |
| 2-06 Zamooneh.mp3 | 2023-11-08 16:43 | 11M | |
| 2-07 Zahre Jodaii.mp3 | 2023-11-08 16:44 | 15M | |
| 2-08 Alame Yekrangi.mp3 | 2023-11-08 16:43 | 11M | |
| 2-09 Nemikham.mp3 | 2023-11-08 16:44 | 12M | |
| 2-10 Tarikhe Eshgh.mp3 | 2023-11-08 16:44 | 14M | |
| 3-01 Zendegi.mp3 | 2023-11-08 16:44 | 12M | |
| 3-02 Saghare Hasty.mp3 | 2023-11-08 16:44 | 14M | |
| 3-03 Sogand.mp3 | 2023-11-08 16:44 | 14M | |
| 3-04 Bahooneh.mp3 | 2023-11-08 16:44 | 13M | |
| 3-05 Ravi.mp3 | 2023-11-08 16:44 | 12M | |
| 3-06 Eshareh.mp3 | 2023-11-08 16:44 | 12M | |
| 3-07 Vasat Mimordam.mp3 | 2023-11-08 16:44 | 14M | |
| 3-08 Yeki Ra Doost M..> | 2023-11-08 16:45 | 24M | |
| 3-09 Saghi.mp3 | 2023-11-08 16:44 | 9.4M | |
| 3-10 Ey Khoda.mp3 | 2023-11-08 16:44 | 12M | |
| 4-01 Shabeh Eshgh.mp3 | 2023-11-08 16:44 | 12M | |
| 4-02 Gol Vajhe.mp3 | 2023-11-08 16:45 | 8.7M | |
| 4-03 Dasthayeh To.mp3 | 2023-11-08 16:45 | 13M | |
| 4-04 Be Joz Khoda Ka..> | 2023-11-08 16:45 | 16M | |
| 4-05 Shoorideh Sar.mp3 | 2023-11-08 16:45 | 8.4M | |
| 4-06 Bezan Tar.mp3 | 2023-11-08 16:45 | 11M | |
| 4-07 Jadoo.mp3 | 2023-11-08 16:45 | 17M | |
| 4-08 Vafayeh Del.mp3 | 2023-11-08 16:45 | 14M | |
| 4-09 Dele Divooneh.mp3 | 2023-11-08 16:45 | 13M | |
| 4-10 Goleh Kaghazi.mp3 | 2023-11-08 16:45 | 11M | |
| 4-11 Sar Be Hava.mp3 | 2023-11-08 16:45 | 13M | |
| Covers/ | 2023-11-08 21:49 | - | |
| Hayedeh - 40 Golden ..> | 2023-11-08 16:45 | 38K | |
