![[ICO]](/icons/blank.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 40 Golden Hits of Mo..> | 2023-11-08 21:51 | - | |
| Be To Miandisham/ | 2023-11-08 21:51 | - | |
| Bibi Gol/ | 2023-11-08 21:51 | - | |
| Esfahan/ | 2023-11-08 21:51 | - | |
| Havas/ | 2023-11-08 21:51 | - | |
| Kabeh/ | 2023-11-08 21:51 | - | |
| Khatereh 7 Sadegh No..> | 2023-11-08 21:51 | - | |
| Lahzeha/ | 2023-11-08 21:51 | - | |
| Live In Concert At U..> | 2023-11-08 21:51 | - | |
| Moama/ | 2023-11-08 21:51 | - | |
| Moein--Ai-zaboonam-L..> | 2024-02-27 14:39 | 0 | |
| Moein-1001-Shab.mp3 | 2024-04-03 18:57 | 9.9M | |
| Moein-Kaftare-Kacol-..> | 2023-11-08 13:23 | 7.7M | |
| Moein-Kaftare-Kacol-..> | 2023-11-08 13:23 | 11M | |
| Moein-Ki-Bishtar-Az-..> | 2023-12-19 07:20 | 7.0M | |
| Moein-Majnon-Ai.mp3 | 2024-01-27 21:58 | 11M | |
| Moein-Peda-Ai-Aron-A..> | 2024-01-25 01:55 | 5.0M | |
| Moein-Tanaz-remix.mp3 | 2024-01-20 14:24 | 7.9M | |
| Moein-Tanaz.mp3 | 2024-01-20 14:18 | 11M | |
| Moein-Yadet-Miad-Moe..> | 2023-11-08 13:22 | 5.6M | |
| Moein-Yekam-Sabr-Kon..> | 2023-11-08 13:23 | 6.6M | |
| Moein-Zaboonam-Laal.mp3 | 2024-02-27 14:39 | 0 | |
| Moein-zaboonam-Laal.mp3 | 2024-02-27 14:39 | 0 | |
| Mosafer/ | 2023-11-08 21:51 | - | |
| Namaz/ | 2023-11-08 21:51 | - | |
| Panjareh/ | 2023-11-08 21:51 | - | |
| Paricheh/ | 2023-11-08 21:51 | - | |
| Parvaz/ | 2023-11-08 21:51 | - | |
| Rhythm of Music/ | 2023-11-08 21:51 | - | |
| Safar/ | 2023-11-08 21:51 | - | |
| Sobhet Bekheyr Azizam/ | 2023-11-08 21:51 | - | |
| Tavalode Eshgh/ | 2023-11-08 21:51 | - | |
| Tolou/ | 2023-11-08 21:51 | - | |
| World of Love/ | 2023-11-08 21:51 | - | |
| Yeki Ra Doost Midaram/ | 2023-11-08 21:51 | - | |